C23H21F2N3O3 — CID 142766117
ethyl 2-[(3S)-6-fluoro-3-[(6-fluoro-1,3-benzoxazol-2-yl)amino]-1,2,3,4-tetrahydrocarbazol-9-yl]acetate (PubChem CID 142766117) has the molecular formula C23H21F2N3O3 and a molecular weight of 425.44 g/mol. Its IUPAC name is ethyl 2-[(3S)-6-fluoro-3-[(6-fluoro-1,3-benzoxazol-2-yl)amino]-1,2,3,4-tetrahydrocarbazol-9-yl]acetate.
| Compound Name | ethyl 2-[(3S)-6-fluoro-3-[(6-fluoro-1,3-benzoxazol-2-yl)amino]-1,2,3,4-tetrahydrocarbazol-9-yl]acetate |
|---|---|
| PubChem CID | 142766117 |
| Molecular Formula | C23H21F2N3O3 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | ethyl 2-[(3S)-6-fluoro-3-[(6-fluoro-1,3-benzoxazol-2-yl)amino]-1,2,3,4-tetrahydrocarbazol-9-yl]acetate |
| SMILES | CCOC(=O)Cn1c2c(c3cc(F)ccc31)C[C@@H](Nc1nc3ccc(F)cc3o1)CC2 |
| InChI | InChI=1S/C23H21F2N3O3/c1-2-30-22(29)12-28-19-7-4-13(24)9-16(19)17-11-15(5-8-20(17)28)26-23-27-18-6-3-14(25)10-21(18)31-23/h3-4,6-7,9-10,15H,2,5,8,11-12H2,1H3,(H,26,27)/t15-/m0/s1 |
| InChIKey | MMOGZEPCZUYKOS-HNNXBMFYSA-N |
| XLogP | 4.59 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|