C35H33FN2O4 — CID 123240495
benzyl 2-[[(3S)-9-(2-ethoxy-2-oxoethyl)-6-fluoro-1,2,3,4-tetrahydrocarbazol-3-yl]amino]-2-naphthalen-1-ylacetate (PubChem CID 123240495) has the molecular formula C35H33FN2O4 and a molecular weight of 564.66 g/mol. Its IUPAC name is benzyl 2-[[(3S)-9-(2-ethoxy-2-oxoethyl)-6-fluoro-1,2,3,4-tetrahydrocarbazol-3-yl]amino]-2-naphthalen-1-ylacetate.
| Compound Name | benzyl 2-[[(3S)-9-(2-ethoxy-2-oxoethyl)-6-fluoro-1,2,3,4-tetrahydrocarbazol-3-yl]amino]-2-naphthalen-1-ylacetate |
|---|---|
| PubChem CID | 123240495 |
| Molecular Formula | C35H33FN2O4 |
| Molecular Weight | 564.66 g/mol |
| Exact Mass | 564.24 |
| IUPAC Name | benzyl 2-[[(3S)-9-(2-ethoxy-2-oxoethyl)-6-fluoro-1,2,3,4-tetrahydrocarbazol-3-yl]amino]-2-naphthalen-1-ylacetate |
| SMILES | CCOC(=O)Cn1c2c(c3cc(F)ccc31)C[C@@H](NC(C(=O)OCc1ccccc1)c1cccc3ccccc13)CC2 |
| InChI | InChI=1S/C35H33FN2O4/c1-2-41-33(39)21-38-31-17-15-25(36)19-29(31)30-20-26(16-18-32(30)38)37-34(35(40)42-22-23-9-4-3-5-10-23)28-14-8-12-24-11-6-7-13-27(24)28/h3-15,17,19,26,34,37H,2,16,18,20-22H2,1H3/t26-,34?/m0/s1 |
| InChIKey | QFWQHKRIHTZDLD-KAWNSFPOSA-N |
| XLogP | 6.43 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.66 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|