C31H37FN2O5 — CID 67205368
3-benzyl-4-[[9-(2-ethoxy-2-oxoethyl)-6-fluoro-1,2,3,4-tetrahydrocarbazol-3-yl]imino]-4-[(2-methylpropan-2-yl)oxy]butanoic acid (PubChem CID 67205368) has the molecular formula C31H37FN2O5 and a molecular weight of 536.64 g/mol. Its IUPAC name is 3-benzyl-4-[[9-(2-ethoxy-2-oxoethyl)-6-fluoro-1,2,3,4-tetrahydrocarbazol-3-yl]imino]-4-[(2-methylpropan-2-yl)oxy]butanoic acid.
| Compound Name | 3-benzyl-4-[[9-(2-ethoxy-2-oxoethyl)-6-fluoro-1,2,3,4-tetrahydrocarbazol-3-yl]imino]-4-[(2-methylpropan-2-yl)oxy]butanoic acid |
|---|---|
| PubChem CID | 67205368 |
| Molecular Formula | C31H37FN2O5 |
| Molecular Weight | 536.64 g/mol |
| Exact Mass | 536.27 |
| IUPAC Name | 3-benzyl-4-[[9-(2-ethoxy-2-oxoethyl)-6-fluoro-1,2,3,4-tetrahydrocarbazol-3-yl]imino]-4-[(2-methylpropan-2-yl)oxy]butanoic acid |
| SMILES | CCOC(=O)Cn1c2c(c3cc(F)ccc31)CC(/N=C(\OC(C)(C)C)C(CC(=O)O)Cc1ccccc1)CC2 |
| InChI | InChI=1S/C31H37FN2O5/c1-5-38-29(37)19-34-26-13-11-22(32)17-24(26)25-18-23(12-14-27(25)34)33-30(39-31(2,3)4)21(16-28(35)36)15-20-9-7-6-8-10-20/h6-11,13,17,21,23H,5,12,14-16,18-19H2,1-4H3,(H,35,36)/b33-30- |
| InChIKey | JBUHCKVRSWRMHX-MEIHLTSWSA-N |
| XLogP | 5.75 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.64 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|