C22H21FN2O3 — CID 25024636
2-[(3R)-6-fluoro-3-[(2-phenylacetyl)amino]-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid (PubChem CID 25024636) has the molecular formula C22H21FN2O3 and a molecular weight of 380.42 g/mol. Its IUPAC name is 2-[(3R)-6-fluoro-3-[(2-phenylacetyl)amino]-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid.
| Compound Name | 2-[(3R)-6-fluoro-3-[(2-phenylacetyl)amino]-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid |
|---|---|
| PubChem CID | 25024636 |
| Molecular Formula | C22H21FN2O3 |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 2-[(3R)-6-fluoro-3-[(2-phenylacetyl)amino]-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid |
| SMILES | O=C(O)Cn1c2c(c3cc(F)ccc31)C[C@H](NC(=O)Cc1ccccc1)CC2 |
| InChI | InChI=1S/C22H21FN2O3/c23-15-6-8-19-17(11-15)18-12-16(7-9-20(18)25(19)13-22(27)28)24-21(26)10-14-4-2-1-3-5-14/h1-6,8,11,16H,7,9-10,12-13H2,(H,24,26)(H,27,28)/t16-/m1/s1 |
| InChIKey | IITNLJJMIZOVJT-MRXNPFEDSA-N |
| XLogP | 3.08 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|