C23H23FN2O5 — CID 66811814
2-[(3S)-6-fluoro-3-[[2-(2-methoxyphenoxy)acetyl]amino]-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid (PubChem CID 66811814) has the molecular formula C23H23FN2O5 and a molecular weight of 426.44 g/mol. Its IUPAC name is 2-[(3S)-6-fluoro-3-[[2-(2-methoxyphenoxy)acetyl]amino]-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid.
| Compound Name | 2-[(3S)-6-fluoro-3-[[2-(2-methoxyphenoxy)acetyl]amino]-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid |
|---|---|
| PubChem CID | 66811814 |
| Molecular Formula | C23H23FN2O5 |
| Molecular Weight | 426.44 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 2-[(3S)-6-fluoro-3-[[2-(2-methoxyphenoxy)acetyl]amino]-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid |
| SMILES | COc1ccccc1OCC(=O)N[C@H]1CCc2c(c3cc(F)ccc3n2CC(=O)O)C1 |
| InChI | InChI=1S/C23H23FN2O5/c1-30-20-4-2-3-5-21(20)31-13-22(27)25-15-7-9-19-17(11-15)16-10-14(24)6-8-18(16)26(19)12-23(28)29/h2-6,8,10,15H,7,9,11-13H2,1H3,(H,25,27)(H,28,29)/t15-/m0/s1 |
| InChIKey | OJZGKILYSGVUNU-HNNXBMFYSA-N |
| XLogP | 2.93 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.44 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|