C25H27FN2O4 — CID 90717454
ethyl 2-[(3S)-6-fluoro-8-methyl-3-(phenylmethoxycarbonylamino)-1,2,3,4-tetrahydrocarbazol-9-yl]acetate (PubChem CID 90717454) has the molecular formula C25H27FN2O4 and a molecular weight of 438.50 g/mol. Its IUPAC name is ethyl 2-[(3S)-6-fluoro-8-methyl-3-(phenylmethoxycarbonylamino)-1,2,3,4-tetrahydrocarbazol-9-yl]acetate.
| Compound Name | ethyl 2-[(3S)-6-fluoro-8-methyl-3-(phenylmethoxycarbonylamino)-1,2,3,4-tetrahydrocarbazol-9-yl]acetate |
|---|---|
| PubChem CID | 90717454 |
| Molecular Formula | C25H27FN2O4 |
| Molecular Weight | 438.50 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | ethyl 2-[(3S)-6-fluoro-8-methyl-3-(phenylmethoxycarbonylamino)-1,2,3,4-tetrahydrocarbazol-9-yl]acetate |
| SMILES | CCOC(=O)Cn1c2c(c3cc(F)cc(C)c31)C[C@@H](NC(=O)OCc1ccccc1)CC2 |
| InChI | InChI=1S/C25H27FN2O4/c1-3-31-23(29)14-28-22-10-9-19(27-25(30)32-15-17-7-5-4-6-8-17)13-20(22)21-12-18(26)11-16(2)24(21)28/h4-8,11-12,19H,3,9-10,13-15H2,1-2H3,(H,27,30)/t19-/m0/s1 |
| InChIKey | AMAMOTQFXDZZDM-IBGZPJMESA-N |
| XLogP | 4.44 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.50 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|