C24H23FN2O4 — CID 66812249
2-[(3R)-8-ethenyl-6-fluoro-3-(phenylmethoxycarbonylamino)-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid (PubChem CID 66812249) has the molecular formula C24H23FN2O4 and a molecular weight of 422.46 g/mol. Its IUPAC name is 2-[(3R)-8-ethenyl-6-fluoro-3-(phenylmethoxycarbonylamino)-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid.
| Compound Name | 2-[(3R)-8-ethenyl-6-fluoro-3-(phenylmethoxycarbonylamino)-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid |
|---|---|
| PubChem CID | 66812249 |
| Molecular Formula | C24H23FN2O4 |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 2-[(3R)-8-ethenyl-6-fluoro-3-(phenylmethoxycarbonylamino)-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid |
| SMILES | C=Cc1cc(F)cc2c3c(n(CC(=O)O)c12)CC[C@@H](NC(=O)OCc1ccccc1)C3 |
| InChI | InChI=1S/C24H23FN2O4/c1-2-16-10-17(25)11-20-19-12-18(8-9-21(19)27(23(16)20)13-22(28)29)26-24(30)31-14-15-6-4-3-5-7-15/h2-7,10-11,18H,1,8-9,12-14H2,(H,26,30)(H,28,29)/t18-/m1/s1 |
| InChIKey | LZCOGUGKMCRMNG-GOSISDBHSA-N |
| XLogP | 4.29 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|