C22H21ClFN3O3 — CID 66812018
2-[3-(benzylcarbamoylamino)-8-chloro-6-fluoro-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid (PubChem CID 66812018) has the molecular formula C22H21ClFN3O3 and a molecular weight of 429.88 g/mol. Its IUPAC name is 2-[3-(benzylcarbamoylamino)-8-chloro-6-fluoro-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid.
| Compound Name | 2-[3-(benzylcarbamoylamino)-8-chloro-6-fluoro-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid |
|---|---|
| PubChem CID | 66812018 |
| Molecular Formula | C22H21ClFN3O3 |
| Molecular Weight | 429.88 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | 2-[3-(benzylcarbamoylamino)-8-chloro-6-fluoro-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid |
| SMILES | O=C(O)Cn1c2c(c3cc(F)cc(Cl)c31)CC(NC(=O)NCc1ccccc1)CC2 |
| InChI | InChI=1S/C22H21ClFN3O3/c23-18-9-14(24)8-17-16-10-15(6-7-19(16)27(21(17)18)12-20(28)29)26-22(30)25-11-13-4-2-1-3-5-13/h1-5,8-9,15H,6-7,10-12H2,(H,28,29)(H2,25,26,30) |
| InChIKey | RLKNXLJVWBFETI-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.88 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|