C24H22ClFN2O5 — CID 66811406
2-[3-[3-(1,3-benzodioxol-5-yl)propanoylamino]-8-chloro-6-fluoro-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid (PubChem CID 66811406) has the molecular formula C24H22ClFN2O5 and a molecular weight of 472.90 g/mol. Its IUPAC name is 2-[3-[3-(1,3-benzodioxol-5-yl)propanoylamino]-8-chloro-6-fluoro-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid.
| Compound Name | 2-[3-[3-(1,3-benzodioxol-5-yl)propanoylamino]-8-chloro-6-fluoro-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid |
|---|---|
| PubChem CID | 66811406 |
| Molecular Formula | C24H22ClFN2O5 |
| Molecular Weight | 472.90 g/mol |
| Exact Mass | 472.12 |
| IUPAC Name | 2-[3-[3-(1,3-benzodioxol-5-yl)propanoylamino]-8-chloro-6-fluoro-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid |
| SMILES | O=C(O)Cn1c2c(c3cc(F)cc(Cl)c31)CC(NC(=O)CCc1ccc3c(c1)OCO3)CC2 |
| InChI | InChI=1S/C24H22ClFN2O5/c25-18-9-14(26)8-17-16-10-15(3-4-19(16)28(24(17)18)11-23(30)31)27-22(29)6-2-13-1-5-20-21(7-13)33-12-32-20/h1,5,7-9,15H,2-4,6,10-12H2,(H,27,29)(H,30,31) |
| InChIKey | QUBKOYICJPPWHN-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.90 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|