C26H27FN2O5 — CID 67205799
2-[3-[3-(1,3-benzodioxol-5-yl)propanoylamino]-6-fluoro-1,2,3,4-tetrahydrocarbazol-9-yl]butanoic acid (PubChem CID 67205799) has the molecular formula C26H27FN2O5 and a molecular weight of 466.51 g/mol. Its IUPAC name is 2-[3-[3-(1,3-benzodioxol-5-yl)propanoylamino]-6-fluoro-1,2,3,4-tetrahydrocarbazol-9-yl]butanoic acid.
| Compound Name | 2-[3-[3-(1,3-benzodioxol-5-yl)propanoylamino]-6-fluoro-1,2,3,4-tetrahydrocarbazol-9-yl]butanoic acid |
|---|---|
| PubChem CID | 67205799 |
| Molecular Formula | C26H27FN2O5 |
| Molecular Weight | 466.51 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | 2-[3-[3-(1,3-benzodioxol-5-yl)propanoylamino]-6-fluoro-1,2,3,4-tetrahydrocarbazol-9-yl]butanoic acid |
| SMILES | CCC(C(=O)O)n1c2c(c3cc(F)ccc31)CC(NC(=O)CCc1ccc3c(c1)OCO3)CC2 |
| InChI | InChI=1S/C26H27FN2O5/c1-2-20(26(31)32)29-21-7-5-16(27)12-18(21)19-13-17(6-8-22(19)29)28-25(30)10-4-15-3-9-23-24(11-15)34-14-33-23/h3,5,7,9,11-12,17,20H,2,4,6,8,10,13-14H2,1H3,(H,28,30)(H,31,32) |
| InChIKey | IPZORYQSACGEBP-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.51 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |