C25H28N2O3 — CID 67206539
2-[(3R)-3-(3-phenylpropanoylamino)-1,2,3,4-tetrahydrocarbazol-9-yl]butanoic acid (PubChem CID 67206539) has the molecular formula C25H28N2O3 and a molecular weight of 404.51 g/mol. Its IUPAC name is 2-[(3R)-3-(3-phenylpropanoylamino)-1,2,3,4-tetrahydrocarbazol-9-yl]butanoic acid.
| Compound Name | 2-[(3R)-3-(3-phenylpropanoylamino)-1,2,3,4-tetrahydrocarbazol-9-yl]butanoic acid |
|---|---|
| PubChem CID | 67206539 |
| Molecular Formula | C25H28N2O3 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | 2-[(3R)-3-(3-phenylpropanoylamino)-1,2,3,4-tetrahydrocarbazol-9-yl]butanoic acid |
| SMILES | CCC(C(=O)O)n1c2c(c3ccccc31)C[C@H](NC(=O)CCc1ccccc1)CC2 |
| InChI | InChI=1S/C25H28N2O3/c1-2-21(25(29)30)27-22-11-7-6-10-19(22)20-16-18(13-14-23(20)27)26-24(28)15-12-17-8-4-3-5-9-17/h3-11,18,21H,2,12-16H2,1H3,(H,26,28)(H,29,30)/t18-,21?/m1/s1 |
| InChIKey | AMUJCERZMSPGOD-ITUIMRKVSA-N |
| XLogP | 4.28 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |