C16H20N2O2 — CID 67206176
2-[(3R)-3-amino-1,2,3,4-tetrahydrocarbazol-9-yl]butanoic acid (PubChem CID 67206176) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 2-[(3R)-3-amino-1,2,3,4-tetrahydrocarbazol-9-yl]butanoic acid.
| Compound Name | 2-[(3R)-3-amino-1,2,3,4-tetrahydrocarbazol-9-yl]butanoic acid |
|---|---|
| PubChem CID | 67206176 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 2-[(3R)-3-amino-1,2,3,4-tetrahydrocarbazol-9-yl]butanoic acid |
| SMILES | CCC(C(=O)O)n1c2c(c3ccccc31)C[C@H](N)CC2 |
| InChI | InChI=1S/C16H20N2O2/c1-2-13(16(19)20)18-14-6-4-3-5-11(14)12-9-10(17)7-8-15(12)18/h3-6,10,13H,2,7-9,17H2,1H3,(H,19,20)/t10-,13?/m1/s1 |
| InChIKey | MJPWEKFDELUSJG-VUUHIHSGSA-N |
| XLogP | 2.49 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |