C14H16N2O — CID 84613056
9-methyl-1,2,3,4-tetrahydrocarbazole-3-carboxamide (PubChem CID 84613056) has the molecular formula C14H16N2O and a molecular weight of 228.30 g/mol. Its IUPAC name is 9-methyl-1,2,3,4-tetrahydrocarbazole-3-carboxamide.
| Compound Name | 9-methyl-1,2,3,4-tetrahydrocarbazole-3-carboxamide |
|---|---|
| PubChem CID | 84613056 |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 9-methyl-1,2,3,4-tetrahydrocarbazole-3-carboxamide |
| SMILES | Cn1c2c(c3ccccc31)CC(C(N)=O)CC2 |
| InChI | InChI=1S/C14H16N2O/c1-16-12-5-3-2-4-10(12)11-8-9(14(15)17)6-7-13(11)16/h2-5,9H,6-8H2,1H3,(H2,15,17) |
| InChIKey | CANLSZDXTRGCEP-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|