C22H20ClFN2O4 — CID 66812069
2-[8-chloro-6-fluoro-3-(phenylmethoxycarbonylamino)-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid (PubChem CID 66812069) has the molecular formula C22H20ClFN2O4 and a molecular weight of 430.86 g/mol. Its IUPAC name is 2-[8-chloro-6-fluoro-3-(phenylmethoxycarbonylamino)-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid.
| Compound Name | 2-[8-chloro-6-fluoro-3-(phenylmethoxycarbonylamino)-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid |
|---|---|
| PubChem CID | 66812069 |
| Molecular Formula | C22H20ClFN2O4 |
| Molecular Weight | 430.86 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | 2-[8-chloro-6-fluoro-3-(phenylmethoxycarbonylamino)-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid |
| SMILES | O=C(O)Cn1c2c(c3cc(F)cc(Cl)c31)CC(NC(=O)OCc1ccccc1)CC2 |
| InChI | InChI=1S/C22H20ClFN2O4/c23-18-9-14(24)8-17-16-10-15(6-7-19(16)26(21(17)18)11-20(27)28)25-22(29)30-12-13-4-2-1-3-5-13/h1-5,8-9,15H,6-7,10-12H2,(H,25,29)(H,27,28) |
| InChIKey | UVVOSQSXPOQGQG-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.86 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|