C19H25N3O3 — CID 66811492
2-[3-(butylcarbamoylamino)-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid (PubChem CID 66811492) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is 2-[3-(butylcarbamoylamino)-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid.
| Compound Name | 2-[3-(butylcarbamoylamino)-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid |
|---|---|
| PubChem CID | 66811492 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | 2-[3-(butylcarbamoylamino)-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid |
| SMILES | CCCCNC(=O)NC1CCc2c(c3ccccc3n2CC(=O)O)C1 |
| InChI | InChI=1S/C19H25N3O3/c1-2-3-10-20-19(25)21-13-8-9-17-15(11-13)14-6-4-5-7-16(14)22(17)12-18(23)24/h4-7,13H,2-3,8-12H2,1H3,(H,23,24)(H2,20,21,25) |
| InChIKey | FYBHFEBNSXZRHU-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|