C16H21ClN2O2 — CID 86614329
ethyl 2-(7-methyl-1,2,3,4-tetrahydropyrido[4,3-b]indol-5-yl)acetate;hydrochloride (PubChem CID 86614329) has the molecular formula C16H21ClN2O2 and a molecular weight of 308.81 g/mol. Its IUPAC name is ethyl 2-(7-methyl-1,2,3,4-tetrahydropyrido[4,3-b]indol-5-yl)acetate;hydrochloride.
| Compound Name | ethyl 2-(7-methyl-1,2,3,4-tetrahydropyrido[4,3-b]indol-5-yl)acetate;hydrochloride |
|---|---|
| PubChem CID | 86614329 |
| Molecular Formula | C16H21ClN2O2 |
| Molecular Weight | 308.81 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | ethyl 2-(7-methyl-1,2,3,4-tetrahydropyrido[4,3-b]indol-5-yl)acetate;hydrochloride |
| SMILES | CCOC(=O)Cn1c2c(c3ccc(C)cc31)CNCC2.Cl |
| InChI | InChI=1S/C16H20N2O2.ClH/c1-3-20-16(19)10-18-14-6-7-17-9-13(14)12-5-4-11(2)8-15(12)18;/h4-5,8,17H,3,6-7,9-10H2,1-2H3;1H |
| InChIKey | NQJQCHMLTBXJMS-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.81 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|