C19H27N2O2+ — CID 139738845
ethyl 3-(2,2,8-trimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-ium-5-yl)propanoate (PubChem CID 139738845) has the molecular formula C19H27N2O2+ and a molecular weight of 315.44 g/mol. Its IUPAC name is ethyl 3-(2,2,8-trimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-ium-5-yl)propanoate.
| Compound Name | ethyl 3-(2,2,8-trimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-ium-5-yl)propanoate |
|---|---|
| PubChem CID | 139738845 |
| Molecular Formula | C19H27N2O2+ |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.21 |
| IUPAC Name | ethyl 3-(2,2,8-trimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-ium-5-yl)propanoate |
| SMILES | CCOC(=O)CCn1c2c(c3cc(C)ccc31)C[N+](C)(C)CC2 |
| InChI | InChI=1S/C19H27N2O2/c1-5-23-19(22)8-10-20-17-7-6-14(2)12-15(17)16-13-21(3,4)11-9-18(16)20/h6-7,12H,5,8-11,13H2,1-4H3/q+1 |
| InChIKey | WOAMEEIBMUMAHB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|