C29H40N3O2+ — CID 53327376
[2,8-dimethyl-5-[2-(6-methyl-3-pyridinyl)ethyl]-3,4-dihydro-1H-pyrido[4,3-b]indol-2-ium-2-yl]methyl 2,2-dimethylpentanoate (PubChem CID 53327376) has the molecular formula C29H40N3O2+ and a molecular weight of 462.66 g/mol. Its IUPAC name is [2,8-dimethyl-5-[2-(6-methyl-3-pyridinyl)ethyl]-3,4-dihydro-1H-pyrido[4,3-b]indol-2-ium-2-yl]methyl 2,2-dimethylpentanoate.
| Compound Name | [2,8-dimethyl-5-[2-(6-methyl-3-pyridinyl)ethyl]-3,4-dihydro-1H-pyrido[4,3-b]indol-2-ium-2-yl]methyl 2,2-dimethylpentanoate |
|---|---|
| PubChem CID | 53327376 |
| Molecular Formula | C29H40N3O2+ |
| Molecular Weight | 462.66 g/mol |
| Exact Mass | 462.31 |
| IUPAC Name | [2,8-dimethyl-5-[2-(6-methyl-3-pyridinyl)ethyl]-3,4-dihydro-1H-pyrido[4,3-b]indol-2-ium-2-yl]methyl 2,2-dimethylpentanoate |
| SMILES | CCCC(C)(C)C(=O)OC[N+]1(C)CCc2c(c3cc(C)ccc3n2CCc2ccc(C)nc2)C1 |
| InChI | InChI=1S/C29H40N3O2/c1-7-14-29(4,5)28(33)34-20-32(6)16-13-27-25(19-32)24-17-21(2)8-11-26(24)31(27)15-12-23-10-9-22(3)30-18-23/h8-11,17-18H,7,12-16,19-20H2,1-6H3/q+1 |
| InChIKey | YBYXGSPBLWXUPP-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.66 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|