C19H20ClN3 — CID 123644290
8-chloro-5-[2-(6-methyl-3-pyridinyl)ethyl]-1,2,3,4-tetrahydropyrido[4,3-b]indole (PubChem CID 123644290) has the molecular formula C19H20ClN3 and a molecular weight of 325.84 g/mol. Its IUPAC name is 8-chloro-5-[2-(6-methyl-3-pyridinyl)ethyl]-1,2,3,4-tetrahydropyrido[4,3-b]indole.
| Compound Name | 8-chloro-5-[2-(6-methyl-3-pyridinyl)ethyl]-1,2,3,4-tetrahydropyrido[4,3-b]indole |
|---|---|
| PubChem CID | 123644290 |
| Molecular Formula | C19H20ClN3 |
| Molecular Weight | 325.84 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 8-chloro-5-[2-(6-methyl-3-pyridinyl)ethyl]-1,2,3,4-tetrahydropyrido[4,3-b]indole |
| SMILES | Cc1ccc(CCn2c3c(c4cc(Cl)ccc42)CNCC3)cn1 |
| InChI | InChI=1S/C19H20ClN3/c1-13-2-3-14(11-22-13)7-9-23-18-5-4-15(20)10-16(18)17-12-21-8-6-19(17)23/h2-5,10-11,21H,6-9,12H2,1H3 |
| InChIKey | MOYBMYBFAOFLMC-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.84 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|