C17H20N4 — CID 123760158
5-[2-(1H-imidazol-5-yl)ethyl]-8-methyl-1,2,3,4-tetrahydropyrido[4,3-b]indole (PubChem CID 123760158) has the molecular formula C17H20N4 and a molecular weight of 280.37 g/mol. Its IUPAC name is 5-[2-(1H-imidazol-5-yl)ethyl]-8-methyl-1,2,3,4-tetrahydropyrido[4,3-b]indole.
| Compound Name | 5-[2-(1H-imidazol-5-yl)ethyl]-8-methyl-1,2,3,4-tetrahydropyrido[4,3-b]indole |
|---|---|
| PubChem CID | 123760158 |
| Molecular Formula | C17H20N4 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 5-[2-(1H-imidazol-5-yl)ethyl]-8-methyl-1,2,3,4-tetrahydropyrido[4,3-b]indole |
| SMILES | Cc1ccc2c(c1)c1c(n2CCc2cnc[nH]2)CCNC1 |
| InChI | InChI=1S/C17H20N4/c1-12-2-3-16-14(8-12)15-10-18-6-4-17(15)21(16)7-5-13-9-19-11-20-13/h2-3,8-9,11,18H,4-7,10H2,1H3,(H,19,20) |
| InChIKey | CCZGCAXPHIPPHL-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 45.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|