C23H31N3 — CID 143998170
2,8-dimethyl-5-[2-(6-methyl-3-pyridinyl)ethyl]-3,4-dihydro-1H-pyrido[4,3-b]indole;ethane (PubChem CID 143998170) has the molecular formula C23H31N3 and a molecular weight of 349.52 g/mol. Its IUPAC name is 2,8-dimethyl-5-[2-(6-methyl-3-pyridinyl)ethyl]-3,4-dihydro-1H-pyrido[4,3-b]indole;ethane.
| Compound Name | 2,8-dimethyl-5-[2-(6-methyl-3-pyridinyl)ethyl]-3,4-dihydro-1H-pyrido[4,3-b]indole;ethane |
|---|---|
| PubChem CID | 143998170 |
| Molecular Formula | C23H31N3 |
| Molecular Weight | 349.52 g/mol |
| Exact Mass | 349.25 |
| IUPAC Name | 2,8-dimethyl-5-[2-(6-methyl-3-pyridinyl)ethyl]-3,4-dihydro-1H-pyrido[4,3-b]indole;ethane |
| SMILES | CC.Cc1ccc2c(c1)c1c(n2CCc2ccc(C)nc2)CCN(C)C1 |
| InChI | InChI=1S/C21H25N3.C2H6/c1-15-4-7-20-18(12-15)19-14-23(3)10-9-21(19)24(20)11-8-17-6-5-16(2)22-13-17;1-2/h4-7,12-13H,8-11,14H2,1-3H3;1-2H3 |
| InChIKey | QNFBJTGHPAOEHJ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.52 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|