C25H33N3O — CID 59368223
4-[9-methyl-6-[2-(6-methyl-3-pyridinyl)ethyl]-1,2,4,5-tetrahydroazepino[4,5-b]indol-3-yl]butan-1-ol (PubChem CID 59368223) has the molecular formula C25H33N3O and a molecular weight of 391.56 g/mol. Its IUPAC name is 4-[9-methyl-6-[2-(6-methyl-3-pyridinyl)ethyl]-1,2,4,5-tetrahydroazepino[4,5-b]indol-3-yl]butan-1-ol.
| Compound Name | 4-[9-methyl-6-[2-(6-methyl-3-pyridinyl)ethyl]-1,2,4,5-tetrahydroazepino[4,5-b]indol-3-yl]butan-1-ol |
|---|---|
| PubChem CID | 59368223 |
| Molecular Formula | C25H33N3O |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.26 |
| IUPAC Name | 4-[9-methyl-6-[2-(6-methyl-3-pyridinyl)ethyl]-1,2,4,5-tetrahydroazepino[4,5-b]indol-3-yl]butan-1-ol |
| SMILES | Cc1ccc2c(c1)c1c(n2CCc2ccc(C)nc2)CCN(CCCCO)CC1 |
| InChI | InChI=1S/C25H33N3O/c1-19-5-8-24-23(17-19)22-10-13-27(12-3-4-16-29)14-11-25(22)28(24)15-9-21-7-6-20(2)26-18-21/h5-8,17-18,29H,3-4,9-16H2,1-2H3 |
| InChIKey | POTDVRUSEMCCFX-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|