C20H24Cl2FN3 — CID 146061141
8-fluoro-2-methyl-5-[2-(6-methyl-3-pyridinyl)ethyl]-3,4-dihydro-1H-pyrido[4,3-b]indole;dihydrochloride (PubChem CID 146061141) has the molecular formula C20H24Cl2FN3 and a molecular weight of 396.34 g/mol. Its IUPAC name is 8-fluoro-2-methyl-5-[2-(6-methyl-3-pyridinyl)ethyl]-3,4-dihydro-1H-pyrido[4,3-b]indole;dihydrochloride.
| Compound Name | 8-fluoro-2-methyl-5-[2-(6-methyl-3-pyridinyl)ethyl]-3,4-dihydro-1H-pyrido[4,3-b]indole;dihydrochloride |
|---|---|
| PubChem CID | 146061141 |
| Molecular Formula | C20H24Cl2FN3 |
| Molecular Weight | 396.34 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 8-fluoro-2-methyl-5-[2-(6-methyl-3-pyridinyl)ethyl]-3,4-dihydro-1H-pyrido[4,3-b]indole;dihydrochloride |
| SMILES | Cc1ccc(CCn2c3c(c4cc(F)ccc42)CN(C)CC3)cn1.Cl.Cl |
| InChI | InChI=1S/C20H22FN3.2ClH/c1-14-3-4-15(12-22-14)7-10-24-19-6-5-16(21)11-17(19)18-13-23(2)9-8-20(18)24;;/h3-6,11-12H,7-10,13H2,1-2H3;2*1H |
| InChIKey | BVCJHCMNZDBUHS-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.34 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|