C21H23FN2O — CID 46225027
8-fluoro-5-[2-(4-methoxyphenyl)ethyl]-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole (PubChem CID 46225027) has the molecular formula C21H23FN2O and a molecular weight of 338.43 g/mol. Its IUPAC name is 8-fluoro-5-[2-(4-methoxyphenyl)ethyl]-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole.
| Compound Name | 8-fluoro-5-[2-(4-methoxyphenyl)ethyl]-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 46225027 |
| Molecular Formula | C21H23FN2O |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | 8-fluoro-5-[2-(4-methoxyphenyl)ethyl]-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole |
| SMILES | COc1ccc(CCn2c3c(c4cc(F)ccc42)CN(C)CC3)cc1 |
| InChI | InChI=1S/C21H23FN2O/c1-23-11-10-21-19(14-23)18-13-16(22)5-8-20(18)24(21)12-9-15-3-6-17(25-2)7-4-15/h3-8,13H,9-12,14H2,1-2H3 |
| InChIKey | PWXLJFASAVPIDI-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 17.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|