C21H23FN2 — CID 144579435
9-[2-(4-fluorophenyl)ethyl]-2,6-dimethyl-3,4-dihydro-1H-pyrido[3,4-b]indole (PubChem CID 144579435) has the molecular formula C21H23FN2 and a molecular weight of 322.43 g/mol. Its IUPAC name is 9-[2-(4-fluorophenyl)ethyl]-2,6-dimethyl-3,4-dihydro-1H-pyrido[3,4-b]indole.
| Compound Name | 9-[2-(4-fluorophenyl)ethyl]-2,6-dimethyl-3,4-dihydro-1H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 144579435 |
| Molecular Formula | C21H23FN2 |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 9-[2-(4-fluorophenyl)ethyl]-2,6-dimethyl-3,4-dihydro-1H-pyrido[3,4-b]indole |
| SMILES | Cc1ccc2c(c1)c1c(n2CCc2ccc(F)cc2)CN(C)CC1 |
| InChI | InChI=1S/C21H23FN2/c1-15-3-8-20-19(13-15)18-10-11-23(2)14-21(18)24(20)12-9-16-4-6-17(22)7-5-16/h3-8,13H,9-12,14H2,1-2H3 |
| InChIKey | BDNVTANWLKREDU-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|