C18H26N2 — CID 66614798
5-heptyl-1,2,3,4-tetrahydropyrido[4,3-b]indole (PubChem CID 66614798) has the molecular formula C18H26N2 and a molecular weight of 270.42 g/mol. Its IUPAC name is 5-heptyl-1,2,3,4-tetrahydropyrido[4,3-b]indole.
| Compound Name | 5-heptyl-1,2,3,4-tetrahydropyrido[4,3-b]indole |
|---|---|
| PubChem CID | 66614798 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | 5-heptyl-1,2,3,4-tetrahydropyrido[4,3-b]indole |
| SMILES | CCCCCCCn1c2c(c3ccccc31)CNCC2 |
| InChI | InChI=1S/C18H26N2/c1-2-3-4-5-8-13-20-17-10-7-6-9-15(17)16-14-19-12-11-18(16)20/h6-7,9-10,19H,2-5,8,11-14H2,1H3 |
| InChIKey | WGDLHMJLRZNXDT-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|