C13H14N2 — CID 68728829
5-ethenyl-1,2,3,4-tetrahydropyrido[4,3-b]indole (PubChem CID 68728829) has the molecular formula C13H14N2 and a molecular weight of 198.27 g/mol. Its IUPAC name is 5-ethenyl-1,2,3,4-tetrahydropyrido[4,3-b]indole.
| Compound Name | 5-ethenyl-1,2,3,4-tetrahydropyrido[4,3-b]indole |
|---|---|
| PubChem CID | 68728829 |
| Molecular Formula | C13H14N2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 5-ethenyl-1,2,3,4-tetrahydropyrido[4,3-b]indole |
| SMILES | C=Cn1c2c(c3ccccc31)CNCC2 |
| InChI | InChI=1S/C13H14N2/c1-2-15-12-6-4-3-5-10(12)11-9-14-8-7-13(11)15/h2-6,14H,1,7-9H2 |
| InChIKey | KGWTUPZUHIAZPI-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |