C25H32ClN3 — CID 91315071
8-chloro-3-methyl-5-[2-(6-methyl-3-pyridinyl)ethyl]-2-pentyl-3,4-dihydro-1H-pyrido[4,3-b]indole (PubChem CID 91315071) has the molecular formula C25H32ClN3 and a molecular weight of 410.01 g/mol. Its IUPAC name is 8-chloro-3-methyl-5-[2-(6-methyl-3-pyridinyl)ethyl]-2-pentyl-3,4-dihydro-1H-pyrido[4,3-b]indole.
| Compound Name | 8-chloro-3-methyl-5-[2-(6-methyl-3-pyridinyl)ethyl]-2-pentyl-3,4-dihydro-1H-pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 91315071 |
| Molecular Formula | C25H32ClN3 |
| Molecular Weight | 410.01 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | 8-chloro-3-methyl-5-[2-(6-methyl-3-pyridinyl)ethyl]-2-pentyl-3,4-dihydro-1H-pyrido[4,3-b]indole |
| SMILES | CCCCCN1Cc2c(n(CCc3ccc(C)nc3)c3ccc(Cl)cc23)CC1C |
| InChI | InChI=1S/C25H32ClN3/c1-4-5-6-12-28-17-23-22-15-21(26)9-10-24(22)29(25(23)14-19(28)3)13-11-20-8-7-18(2)27-16-20/h7-10,15-16,19H,4-6,11-14,17H2,1-3H3 |
| InChIKey | IJNFXGDNEFQOBT-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.01 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|