C23H27ClN2 — CID 142759098
8-chloro-2-ethyl-3-methyl-5-[2-(3-methylphenyl)ethyl]-3,4-dihydro-1H-pyrido[4,3-b]indole (PubChem CID 142759098) has the molecular formula C23H27ClN2 and a molecular weight of 366.94 g/mol. Its IUPAC name is 8-chloro-2-ethyl-3-methyl-5-[2-(3-methylphenyl)ethyl]-3,4-dihydro-1H-pyrido[4,3-b]indole.
| Compound Name | 8-chloro-2-ethyl-3-methyl-5-[2-(3-methylphenyl)ethyl]-3,4-dihydro-1H-pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 142759098 |
| Molecular Formula | C23H27ClN2 |
| Molecular Weight | 366.94 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 8-chloro-2-ethyl-3-methyl-5-[2-(3-methylphenyl)ethyl]-3,4-dihydro-1H-pyrido[4,3-b]indole |
| SMILES | CCN1Cc2c(n(CCc3cccc(C)c3)c3ccc(Cl)cc23)CC1C |
| InChI | InChI=1S/C23H27ClN2/c1-4-25-15-21-20-14-19(24)8-9-22(20)26(23(21)13-17(25)3)11-10-18-7-5-6-16(2)12-18/h5-9,12,14,17H,4,10-11,13,15H2,1-3H3 |
| InChIKey | FGQBODXTBXJECX-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.94 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|