C23H28N2 — CID 142758902
1,2,3-trimethyl-5-[2-(3-methylphenyl)ethyl]-3,4-dihydro-1H-pyrido[4,3-b]indole (PubChem CID 142758902) has the molecular formula C23H28N2 and a molecular weight of 332.49 g/mol. Its IUPAC name is 1,2,3-trimethyl-5-[2-(3-methylphenyl)ethyl]-3,4-dihydro-1H-pyrido[4,3-b]indole.
| Compound Name | 1,2,3-trimethyl-5-[2-(3-methylphenyl)ethyl]-3,4-dihydro-1H-pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 142758902 |
| Molecular Formula | C23H28N2 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.23 |
| IUPAC Name | 1,2,3-trimethyl-5-[2-(3-methylphenyl)ethyl]-3,4-dihydro-1H-pyrido[4,3-b]indole |
| SMILES | Cc1cccc(CCn2c3c(c4ccccc42)C(C)N(C)C(C)C3)c1 |
| InChI | InChI=1S/C23H28N2/c1-16-8-7-9-19(14-16)12-13-25-21-11-6-5-10-20(21)23-18(3)24(4)17(2)15-22(23)25/h5-11,14,17-18H,12-13,15H2,1-4H3 |
| InChIKey | FDYSUISFLTVWAK-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|