C24H30N2O — CID 142759561
8-methoxy-1,2,3-trimethyl-5-(3-phenylpropyl)-3,4-dihydro-1H-pyrido[4,3-b]indole (PubChem CID 142759561) has the molecular formula C24H30N2O and a molecular weight of 362.52 g/mol. Its IUPAC name is 8-methoxy-1,2,3-trimethyl-5-(3-phenylpropyl)-3,4-dihydro-1H-pyrido[4,3-b]indole.
| Compound Name | 8-methoxy-1,2,3-trimethyl-5-(3-phenylpropyl)-3,4-dihydro-1H-pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 142759561 |
| Molecular Formula | C24H30N2O |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | 8-methoxy-1,2,3-trimethyl-5-(3-phenylpropyl)-3,4-dihydro-1H-pyrido[4,3-b]indole |
| SMILES | COc1ccc2c(c1)c1c(n2CCCc2ccccc2)CC(C)N(C)C1C |
| InChI | InChI=1S/C24H30N2O/c1-17-15-23-24(18(2)25(17)3)21-16-20(27-4)12-13-22(21)26(23)14-8-11-19-9-6-5-7-10-19/h5-7,9-10,12-13,16-18H,8,11,14-15H2,1-4H3 |
| InChIKey | FGPVMJDIEHDEIM-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 17.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|