C21H24ClN3 — CID 142759453
6-chloro-1,2,3-trimethyl-5-(2-pyridin-2-ylethyl)-3,4-dihydro-1H-pyrido[4,3-b]indole (PubChem CID 142759453) has the molecular formula C21H24ClN3 and a molecular weight of 353.90 g/mol. Its IUPAC name is 6-chloro-1,2,3-trimethyl-5-(2-pyridin-2-ylethyl)-3,4-dihydro-1H-pyrido[4,3-b]indole.
| Compound Name | 6-chloro-1,2,3-trimethyl-5-(2-pyridin-2-ylethyl)-3,4-dihydro-1H-pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 142759453 |
| Molecular Formula | C21H24ClN3 |
| Molecular Weight | 353.90 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 6-chloro-1,2,3-trimethyl-5-(2-pyridin-2-ylethyl)-3,4-dihydro-1H-pyrido[4,3-b]indole |
| SMILES | CC1Cc2c(c3cccc(Cl)c3n2CCc2ccccn2)C(C)N1C |
| InChI | InChI=1S/C21H24ClN3/c1-14-13-19-20(15(2)24(14)3)17-8-6-9-18(22)21(17)25(19)12-10-16-7-4-5-11-23-16/h4-9,11,14-15H,10,12-13H2,1-3H3 |
| InChIKey | IKUQKVRIDDLHCY-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.90 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|