C33H42N6 — CID 10530041
1,7,9-trimethyl-3,5,12-tris(2-pyridin-2-ylethyl)-3,5,12-triazatetracyclo[5.3.1.12,6.04,9]dodecane (PubChem CID 10530041) has the molecular formula C33H42N6 and a molecular weight of 522.74 g/mol. Its IUPAC name is 1,7,9-trimethyl-3,5,12-tris(2-pyridin-2-ylethyl)-3,5,12-triazatetracyclo[5.3.1.12,6.04,9]dodecane.
| Compound Name | 1,7,9-trimethyl-3,5,12-tris(2-pyridin-2-ylethyl)-3,5,12-triazatetracyclo[5.3.1.12,6.04,9]dodecane |
|---|---|
| PubChem CID | 10530041 |
| Molecular Formula | C33H42N6 |
| Molecular Weight | 522.74 g/mol |
| Exact Mass | 522.35 |
| IUPAC Name | 1,7,9-trimethyl-3,5,12-tris(2-pyridin-2-ylethyl)-3,5,12-triazatetracyclo[5.3.1.12,6.04,9]dodecane |
| SMILES | CC12CC3(C)CC(C)(C1)C1N(CCc4ccccn4)C2N(CCc2ccccn2)C3N1CCc1ccccn1 |
| InChI | InChI=1S/C33H42N6/c1-31-22-32(2)24-33(3,23-31)30-38(20-14-26-11-5-8-17-35-26)28(31)37(19-13-25-10-4-7-16-34-25)29(32)39(30)21-15-27-12-6-9-18-36-27/h4-12,16-18,28-30H,13-15,19-24H2,1-3H3 |
| InChIKey | YIAMBYKWZRKRAR-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 48.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.74 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |