C14H20N2OS2 — CID 571499
4-tert-butyl-4-hydroxy-3-(2-pyridin-2-ylethyl)-1,3-thiazolidine-2-thione (PubChem CID 571499) has the molecular formula C14H20N2OS2 and a molecular weight of 296.46 g/mol. Its IUPAC name is 4-tert-butyl-4-hydroxy-3-(2-pyridin-2-ylethyl)-1,3-thiazolidine-2-thione.
| Compound Name | 4-tert-butyl-4-hydroxy-3-(2-pyridin-2-ylethyl)-1,3-thiazolidine-2-thione |
|---|---|
| PubChem CID | 571499 |
| Molecular Formula | C14H20N2OS2 |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 4-tert-butyl-4-hydroxy-3-(2-pyridin-2-ylethyl)-1,3-thiazolidine-2-thione |
| SMILES | CC(C)(C)C1(O)CSC(=S)N1CCc1ccccn1 |
| InChI | InChI=1S/C14H20N2OS2/c1-13(2,3)14(17)10-19-12(18)16(14)9-7-11-6-4-5-8-15-11/h4-6,8,17H,7,9-10H2,1-3H3 |
| InChIKey | SCWOWXPYOZWAQK-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|