C12H19N3S — CID 175881809
5-methyl-3-(2-pyridin-2-ylethyl)-1,3-thiazinan-2-amine (PubChem CID 175881809) has the molecular formula C12H19N3S and a molecular weight of 237.37 g/mol. Its IUPAC name is 5-methyl-3-(2-pyridin-2-ylethyl)-1,3-thiazinan-2-amine.
| Compound Name | 5-methyl-3-(2-pyridin-2-ylethyl)-1,3-thiazinan-2-amine |
|---|---|
| PubChem CID | 175881809 |
| Molecular Formula | C12H19N3S |
| Molecular Weight | 237.37 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 5-methyl-3-(2-pyridin-2-ylethyl)-1,3-thiazinan-2-amine |
| SMILES | CC1CSC(N)N(CCc2ccccn2)C1 |
| InChI | InChI=1S/C12H19N3S/c1-10-8-15(12(13)16-9-10)7-5-11-4-2-3-6-14-11/h2-4,6,10,12H,5,7-9,13H2,1H3 |
| InChIKey | JGVLSSRKGGKIGB-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |