C14H20N2O2S — CID 97227916
methyl 2-[(3R)-4-(2-pyridin-2-ylethyl)thiomorpholin-3-yl]acetate (PubChem CID 97227916) has the molecular formula C14H20N2O2S and a molecular weight of 280.39 g/mol. Its IUPAC name is methyl 2-[(3R)-4-(2-pyridin-2-ylethyl)thiomorpholin-3-yl]acetate.
| Compound Name | methyl 2-[(3R)-4-(2-pyridin-2-ylethyl)thiomorpholin-3-yl]acetate |
|---|---|
| PubChem CID | 97227916 |
| Molecular Formula | C14H20N2O2S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | methyl 2-[(3R)-4-(2-pyridin-2-ylethyl)thiomorpholin-3-yl]acetate |
| SMILES | COC(=O)C[C@@H]1CSCCN1CCc1ccccn1 |
| InChI | InChI=1S/C14H20N2O2S/c1-18-14(17)10-13-11-19-9-8-16(13)7-5-12-4-2-3-6-15-12/h2-4,6,13H,5,7-11H2,1H3/t13-/m1/s1 |
| InChIKey | ZJOIQDAIINEUJM-CYBMUJFWSA-N |
| XLogP | 1.60 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |