C26H34N4O — CID 10621954
(1R,4R,7R,9S)-1,7,9-trimethyl-3,5-bis(2-pyridin-2-ylethyl)-3,5-diazatricyclo[5.3.1.04,9]undecan-2-one (PubChem CID 10621954) has the molecular formula C26H34N4O and a molecular weight of 418.59 g/mol. Its IUPAC name is (1R,4R,7R,9S)-1,7,9-trimethyl-3,5-bis(2-pyridin-2-ylethyl)-3,5-diazatricyclo[5.3.1.04,9]undecan-2-one.
| Compound Name | (1R,4R,7R,9S)-1,7,9-trimethyl-3,5-bis(2-pyridin-2-ylethyl)-3,5-diazatricyclo[5.3.1.04,9]undecan-2-one |
|---|---|
| PubChem CID | 10621954 |
| Molecular Formula | C26H34N4O |
| Molecular Weight | 418.59 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | (1R,4R,7R,9S)-1,7,9-trimethyl-3,5-bis(2-pyridin-2-ylethyl)-3,5-diazatricyclo[5.3.1.04,9]undecan-2-one |
| SMILES | CC12CN(CCc3ccccn3)[C@@H]3N(CCc4ccccn4)C(=O)C(C)(C1)C[C@]3(C)C2 |
| InChI | InChI=1S/C26H34N4O/c1-24-16-25(2)18-26(3,17-24)23(31)30(15-11-21-9-5-7-13-28-21)22(25)29(19-24)14-10-20-8-4-6-12-27-20/h4-9,12-13,22H,10-11,14-19H2,1-3H3/t22-,24?,25+,26?/m1/s1 |
| InChIKey | COOPFEDXOLCPEU-QPUCXAADSA-N |
| XLogP | 3.95 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.59 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |