C21H24N2O — CID 141242897
2,8-dimethyl-5-(2-phenylethyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-3-ol (PubChem CID 141242897) has the molecular formula C21H24N2O and a molecular weight of 320.44 g/mol. Its IUPAC name is 2,8-dimethyl-5-(2-phenylethyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-3-ol.
| Compound Name | 2,8-dimethyl-5-(2-phenylethyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-3-ol |
|---|---|
| PubChem CID | 141242897 |
| Molecular Formula | C21H24N2O |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | 2,8-dimethyl-5-(2-phenylethyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-3-ol |
| SMILES | Cc1ccc2c(c1)c1c(n2CCc2ccccc2)CC(O)N(C)C1 |
| InChI | InChI=1S/C21H24N2O/c1-15-8-9-19-17(12-15)18-14-22(2)21(24)13-20(18)23(19)11-10-16-6-4-3-5-7-16/h3-9,12,21,24H,10-11,13-14H2,1-2H3 |
| InChIKey | REYPACHUQVIFPX-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 28.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|