C28H36N4O4 — CID 53327300
1-[[2,8-dimethyl-5-[2-(6-methyl-3-pyridinyl)ethyl]-3,4-dihydro-1H-pyrido[4,3-b]indol-2-ium-2-yl]methoxy]-N-(1-ethoxy-1-oxopropan-2-yl)methanimidate (PubChem CID 53327300) has the molecular formula C28H36N4O4 and a molecular weight of 492.62 g/mol. Its IUPAC name is 1-[[2,8-dimethyl-5-[2-(6-methyl-3-pyridinyl)ethyl]-3,4-dihydro-1H-pyrido[4,3-b]indol-2-ium-2-yl]methoxy]-N-(1-ethoxy-1-oxopropan-2-yl)methanimidate.
| Compound Name | 1-[[2,8-dimethyl-5-[2-(6-methyl-3-pyridinyl)ethyl]-3,4-dihydro-1H-pyrido[4,3-b]indol-2-ium-2-yl]methoxy]-N-(1-ethoxy-1-oxopropan-2-yl)methanimidate |
|---|---|
| PubChem CID | 53327300 |
| Molecular Formula | C28H36N4O4 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | 1-[[2,8-dimethyl-5-[2-(6-methyl-3-pyridinyl)ethyl]-3,4-dihydro-1H-pyrido[4,3-b]indol-2-ium-2-yl]methoxy]-N-(1-ethoxy-1-oxopropan-2-yl)methanimidate |
| SMILES | CCOC(=O)C(C)/N=C(\[O-])OC[N+]1(C)CCc2c(c3cc(C)ccc3n2CCc2ccc(C)nc2)C1 |
| InChI | InChI=1S/C28H36N4O4/c1-6-35-27(33)21(4)30-28(34)36-18-32(5)14-12-26-24(17-32)23-15-19(2)7-10-25(23)31(26)13-11-22-9-8-20(3)29-16-22/h7-10,15-16,21H,6,11-14,17-18H2,1-5H3 |
| InChIKey | FAOGDGFKXTYTCH-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 88.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|