C38H56N3O2+ — CID 53327419
[2,8-dimethyl-5-[2-(6-methyl-3-pyridinyl)ethyl]-3,4-dihydro-1H-pyrido[4,3-b]indol-2-ium-2-yl]methyl (E)-hexadec-9-enoate (PubChem CID 53327419) has the molecular formula C38H56N3O2+ and a molecular weight of 586.89 g/mol. Its IUPAC name is [2,8-dimethyl-5-[2-(6-methyl-3-pyridinyl)ethyl]-3,4-dihydro-1H-pyrido[4,3-b]indol-2-ium-2-yl]methyl (E)-hexadec-9-enoate.
| Compound Name | [2,8-dimethyl-5-[2-(6-methyl-3-pyridinyl)ethyl]-3,4-dihydro-1H-pyrido[4,3-b]indol-2-ium-2-yl]methyl (E)-hexadec-9-enoate |
|---|---|
| PubChem CID | 53327419 |
| Molecular Formula | C38H56N3O2+ |
| Molecular Weight | 586.89 g/mol |
| Exact Mass | 586.44 |
| IUPAC Name | [2,8-dimethyl-5-[2-(6-methyl-3-pyridinyl)ethyl]-3,4-dihydro-1H-pyrido[4,3-b]indol-2-ium-2-yl]methyl (E)-hexadec-9-enoate |
| SMILES | CCCCCC/C=C/CCCCCCCC(=O)OC[N+]1(C)CCc2c(c3cc(C)ccc3n2CCc2ccc(C)nc2)C1 |
| InChI | InChI=1S/C38H56N3O2/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-38(42)43-30-41(4)26-24-37-35(29-41)34-27-31(2)19-22-36(34)40(37)25-23-33-21-20-32(3)39-28-33/h10-11,19-22,27-28H,5-9,12-18,23-26,29-30H2,1-4H3/q+1/b11-10+ |
| InChIKey | HLEZFISXSZTYMK-ZHACJKMWSA-N |
| XLogP | 9.16 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.89 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|