C19H23IN2O2 — CID 70899536
ethyl 3-(5-iodo-15-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-9-yl)propanoate (PubChem CID 70899536) has the molecular formula C19H23IN2O2 and a molecular weight of 438.31 g/mol. Its IUPAC name is ethyl 3-(5-iodo-15-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-9-yl)propanoate.
| Compound Name | ethyl 3-(5-iodo-15-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-9-yl)propanoate |
|---|---|
| PubChem CID | 70899536 |
| Molecular Formula | C19H23IN2O2 |
| Molecular Weight | 438.31 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | ethyl 3-(5-iodo-15-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-9-yl)propanoate |
| SMILES | CCOC(=O)CCn1c2c(c3cc(I)ccc31)C1CCC(C2)N1C |
| InChI | InChI=1S/C19H23IN2O2/c1-3-24-18(23)8-9-22-15-6-4-12(20)10-14(15)19-16-7-5-13(21(16)2)11-17(19)22/h4,6,10,13,16H,3,5,7-9,11H2,1-2H3 |
| InChIKey | BMHCIEGFZJVFRM-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.31 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|