C17H18ClN3 — CID 59285359
3-(5-chloro-15-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-9-yl)propanenitrile (PubChem CID 59285359) has the molecular formula C17H18ClN3 and a molecular weight of 299.81 g/mol. Its IUPAC name is 3-(5-chloro-15-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-9-yl)propanenitrile.
| Compound Name | 3-(5-chloro-15-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-9-yl)propanenitrile |
|---|---|
| PubChem CID | 59285359 |
| Molecular Formula | C17H18ClN3 |
| Molecular Weight | 299.81 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 3-(5-chloro-15-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-9-yl)propanenitrile |
| SMILES | CN1C2CCC1c1c(n(CCC#N)c3ccc(Cl)cc13)C2 |
| InChI | InChI=1S/C17H18ClN3/c1-20-12-4-6-15(20)17-13-9-11(18)3-5-14(13)21(8-2-7-19)16(17)10-12/h3,5,9,12,15H,2,4,6,8,10H2,1H3 |
| InChIKey | IKOZZSSGXPEPNR-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 31.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.81 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|