C26H27Cl2FN4O2 — CID 51348477
2-chloro-N-[1-(5-chloro-15-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-9-yl)-4-(methylamino)-4-oxobutan-2-yl]-4-fluorobenzamide (PubChem CID 51348477) has the molecular formula C26H27Cl2FN4O2 and a molecular weight of 517.43 g/mol. Its IUPAC name is 2-chloro-N-[1-(5-chloro-15-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-9-yl)-4-(methylamino)-4-oxobutan-2-yl]-4-fluorobenzamide.
| Compound Name | 2-chloro-N-[1-(5-chloro-15-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-9-yl)-4-(methylamino)-4-oxobutan-2-yl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 51348477 |
| Molecular Formula | C26H27Cl2FN4O2 |
| Molecular Weight | 517.43 g/mol |
| Exact Mass | 516.15 |
| IUPAC Name | 2-chloro-N-[1-(5-chloro-15-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-9-yl)-4-(methylamino)-4-oxobutan-2-yl]-4-fluorobenzamide |
| SMILES | CNC(=O)CC(Cn1c2c(c3cc(Cl)ccc31)C1CCC(C2)N1C)NC(=O)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C26H27Cl2FN4O2/c1-30-24(34)11-16(31-26(35)18-6-4-15(29)10-20(18)28)13-33-21-7-3-14(27)9-19(21)25-22-8-5-17(32(22)2)12-23(25)33/h3-4,6-7,9-10,16-17,22H,5,8,11-13H2,1-2H3,(H,30,34)(H,31,35) |
| InChIKey | BXFYLMDBCBAAMJ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 66.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.43 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|