C23H22Cl2N2 — CID 91574189
5-chloro-9-[2-(4-chlorophenyl)prop-1-enyl]-15-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene (PubChem CID 91574189) has the molecular formula C23H22Cl2N2 and a molecular weight of 397.35 g/mol. Its IUPAC name is 5-chloro-9-[2-(4-chlorophenyl)prop-1-enyl]-15-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene.
| Compound Name | 5-chloro-9-[2-(4-chlorophenyl)prop-1-enyl]-15-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene |
|---|---|
| PubChem CID | 91574189 |
| Molecular Formula | C23H22Cl2N2 |
| Molecular Weight | 397.35 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | 5-chloro-9-[2-(4-chlorophenyl)prop-1-enyl]-15-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene |
| SMILES | CC(=Cn1c2c(c3cc(Cl)ccc31)C1CCC(C2)N1C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H22Cl2N2/c1-14(15-3-5-16(24)6-4-15)13-27-20-9-7-17(25)11-19(20)23-21-10-8-18(26(21)2)12-22(23)27/h3-7,9,11,13,18,21H,8,10,12H2,1-2H3 |
| InChIKey | LHWFAFIHCXXLQF-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.35 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |