C17H21ClN2 — CID 143870028
5-chloro-15-methyl-9-propyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene (PubChem CID 143870028) has the molecular formula C17H21ClN2 and a molecular weight of 288.82 g/mol. Its IUPAC name is 5-chloro-15-methyl-9-propyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene.
| Compound Name | 5-chloro-15-methyl-9-propyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene |
|---|---|
| PubChem CID | 143870028 |
| Molecular Formula | C17H21ClN2 |
| Molecular Weight | 288.82 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 5-chloro-15-methyl-9-propyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene |
| SMILES | CCCn1c2c(c3cc(Cl)ccc31)C1CCC(C2)N1C |
| InChI | InChI=1S/C17H21ClN2/c1-3-8-20-14-6-4-11(18)9-13(14)17-15-7-5-12(19(15)2)10-16(17)20/h4,6,9,12,15H,3,5,7-8,10H2,1-2H3 |
| InChIKey | OTVLWWVVGOCFEN-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.82 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|