C23H21Cl3N2 — CID 90799197
5-chloro-9-[2-(3,4-dichlorophenyl)prop-1-enyl]-15-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene (PubChem CID 90799197) has the molecular formula C23H21Cl3N2 and a molecular weight of 431.79 g/mol. Its IUPAC name is 5-chloro-9-[2-(3,4-dichlorophenyl)prop-1-enyl]-15-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene.
| Compound Name | 5-chloro-9-[2-(3,4-dichlorophenyl)prop-1-enyl]-15-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene |
|---|---|
| PubChem CID | 90799197 |
| Molecular Formula | C23H21Cl3N2 |
| Molecular Weight | 431.79 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | 5-chloro-9-[2-(3,4-dichlorophenyl)prop-1-enyl]-15-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene |
| SMILES | CC(=Cn1c2c(c3cc(Cl)ccc31)C1CCC(C2)N1C)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C23H21Cl3N2/c1-13(14-3-6-18(25)19(26)9-14)12-28-20-7-4-15(24)10-17(20)23-21-8-5-16(27(21)2)11-22(23)28/h3-4,6-7,9-10,12,16,21H,5,8,11H2,1-2H3 |
| InChIKey | FVYCXGXPFLJFOK-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.79 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |