C22H24FN3 — CID 142759228
5-fluoro-15-methyl-9-[2-(6-methyl-3-pyridinyl)ethyl]-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene (PubChem CID 142759228) has the molecular formula C22H24FN3 and a molecular weight of 349.45 g/mol. Its IUPAC name is 5-fluoro-15-methyl-9-[2-(6-methyl-3-pyridinyl)ethyl]-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene.
| Compound Name | 5-fluoro-15-methyl-9-[2-(6-methyl-3-pyridinyl)ethyl]-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene |
|---|---|
| PubChem CID | 142759228 |
| Molecular Formula | C22H24FN3 |
| Molecular Weight | 349.45 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | 5-fluoro-15-methyl-9-[2-(6-methyl-3-pyridinyl)ethyl]-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene |
| SMILES | Cc1ccc(CCn2c3c(c4cc(F)ccc42)C2CCC(C3)N2C)cn1 |
| InChI | InChI=1S/C22H24FN3/c1-14-3-4-15(13-24-14)9-10-26-19-7-5-16(23)11-18(19)22-20-8-6-17(25(20)2)12-21(22)26/h3-5,7,11,13,17,20H,6,8-10,12H2,1-2H3 |
| InChIKey | HYYFHZREXDDBPN-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.45 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|