C18H24N2O2 — CID 58159547
ethyl 2-(2,9-dimethyl-1,3,4,5-tetrahydroazepino[4,3-b]indol-6-yl)acetate (PubChem CID 58159547) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is ethyl 2-(2,9-dimethyl-1,3,4,5-tetrahydroazepino[4,3-b]indol-6-yl)acetate.
| Compound Name | ethyl 2-(2,9-dimethyl-1,3,4,5-tetrahydroazepino[4,3-b]indol-6-yl)acetate |
|---|---|
| PubChem CID | 58159547 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | ethyl 2-(2,9-dimethyl-1,3,4,5-tetrahydroazepino[4,3-b]indol-6-yl)acetate |
| SMILES | CCOC(=O)Cn1c2c(c3cc(C)ccc31)CN(C)CCC2 |
| InChI | InChI=1S/C18H24N2O2/c1-4-22-18(21)12-20-16-6-5-9-19(3)11-15(16)14-10-13(2)7-8-17(14)20/h7-8,10H,4-6,9,11-12H2,1-3H3 |
| InChIKey | LBWQMUFPPVDSMA-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|