C23H24ClFN2O2 — CID 71063825
ethyl 3-[2-[(4-chlorophenyl)methyl]-8-fluoro-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]propanoate (PubChem CID 71063825) has the molecular formula C23H24ClFN2O2 and a molecular weight of 414.91 g/mol. Its IUPAC name is ethyl 3-[2-[(4-chlorophenyl)methyl]-8-fluoro-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]propanoate.
| Compound Name | ethyl 3-[2-[(4-chlorophenyl)methyl]-8-fluoro-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]propanoate |
|---|---|
| PubChem CID | 71063825 |
| Molecular Formula | C23H24ClFN2O2 |
| Molecular Weight | 414.91 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | ethyl 3-[2-[(4-chlorophenyl)methyl]-8-fluoro-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]propanoate |
| SMILES | CCOC(=O)CCn1c2c(c3cc(F)ccc31)CN(Cc1ccc(Cl)cc1)CC2 |
| InChI | InChI=1S/C23H24ClFN2O2/c1-2-29-23(28)10-12-27-21-8-7-18(25)13-19(21)20-15-26(11-9-22(20)27)14-16-3-5-17(24)6-4-16/h3-8,13H,2,9-12,14-15H2,1H3 |
| InChIKey | RIJICCMMDFLGPL-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.91 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|