C24H26F3N3O2 — CID 68927277
ethyl 4-[5-(pyridin-4-ylmethyl)-8-(trifluoromethyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl]butanoate (PubChem CID 68927277) has the molecular formula C24H26F3N3O2 and a molecular weight of 445.49 g/mol. Its IUPAC name is ethyl 4-[5-(pyridin-4-ylmethyl)-8-(trifluoromethyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl]butanoate.
| Compound Name | ethyl 4-[5-(pyridin-4-ylmethyl)-8-(trifluoromethyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl]butanoate |
|---|---|
| PubChem CID | 68927277 |
| Molecular Formula | C24H26F3N3O2 |
| Molecular Weight | 445.49 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | ethyl 4-[5-(pyridin-4-ylmethyl)-8-(trifluoromethyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl]butanoate |
| SMILES | CCOC(=O)CCCN1CCc2c(c3cc(C(F)(F)F)ccc3n2Cc2ccncc2)C1 |
| InChI | InChI=1S/C24H26F3N3O2/c1-2-32-23(31)4-3-12-29-13-9-22-20(16-29)19-14-18(24(25,26)27)5-6-21(19)30(22)15-17-7-10-28-11-8-17/h5-8,10-11,14H,2-4,9,12-13,15-16H2,1H3 |
| InChIKey | VOUJOAQFJSJNQO-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.49 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|